C43H78NO8P — CID 165255529
[2-hydroxy-3-[hydroxy-[2-[[(9Z,12Z)-octadeca-9,12-dienoyl]amino]ethoxy]phosphoryl]oxypropyl] (11Z,14Z)-icosa-11,14-dienoate (PubChem CID 165255529) has the molecular formula C43H78NO8P and a molecular weight of 768.07 g/mol. Its IUPAC name is [2-hydroxy-3-[hydroxy-[2-[[(9Z,12Z)-octadeca-9,12-dienoyl]amino]ethoxy]phosphoryl]oxypropyl] (11Z,14Z)-icosa-11,14-dienoate.
| Compound Name | [2-hydroxy-3-[hydroxy-[2-[[(9Z,12Z)-octadeca-9,12-dienoyl]amino]ethoxy]phosphoryl]oxypropyl] (11Z,14Z)-icosa-11,14-dienoate |
|---|---|
| PubChem CID | 165255529 |
| Molecular Formula | C43H78NO8P |
| Molecular Weight | 768.07 g/mol |
| Exact Mass | 767.55 |
| IUPAC Name | [2-hydroxy-3-[hydroxy-[2-[[(9Z,12Z)-octadeca-9,12-dienoyl]amino]ethoxy]phosphoryl]oxypropyl] (11Z,14Z)-icosa-11,14-dienoate |
| SMILES | CCCCC/C=C\C/C=C\CCCCCCCCCC(=O)OCC(O)COP(=O)(O)OCCNC(=O)CCCCCCC/C=C\C/C=C\CCCCC |
| InChI | InChI=1S/C43H78NO8P/c1-3-5-7-9-11-13-15-17-19-20-22-24-26-28-30-32-34-36-43(47)50-39-41(45)40-52-53(48,49)51-38-37-44-42(46)35-33-31-29-27-25-23-21-18-16-14-12-10-8-6-4-2/h11-14,17-19,21,41,45H,3-10,15-16,20,22-40H2,1-2H3,(H,44,46)(H,48,49)/b13-11-,14-12-,19-17-,21-18- |
| InChIKey | MLMNLHUCOIAYSW-QWRCKZSHSA-N |
| XLogP | 11.55 |
| TPSA | 131.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 39 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 768.07 |
| LogP ≤ 5 | 11.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|