C50H84O12S — CID 165260367
[1-[3,5-dihydroxy-6-(hydroxymethyl)-4-sulfooxyoxan-2-yl]oxy-3-[(8Z,11Z,14Z,17Z,20Z,23Z)-hexacosa-8,11,14,17,20,23-hexaenoxy]propan-2-yl] (Z)-pentadec-9-enoate (PubChem CID 165260367) has the molecular formula C50H84O12S and a molecular weight of 909.28 g/mol. Its IUPAC name is [1-[3,5-dihydroxy-6-(hydroxymethyl)-4-sulfooxyoxan-2-yl]oxy-3-[(8Z,11Z,14Z,17Z,20Z,23Z)-hexacosa-8,11,14,17,20,23-hexaenoxy]propan-2-yl] (Z)-pentadec-9-enoate.
| Compound Name | [1-[3,5-dihydroxy-6-(hydroxymethyl)-4-sulfooxyoxan-2-yl]oxy-3-[(8Z,11Z,14Z,17Z,20Z,23Z)-hexacosa-8,11,14,17,20,23-hexaenoxy]propan-2-yl] (Z)-pentadec-9-enoate |
|---|---|
| PubChem CID | 165260367 |
| Molecular Formula | C50H84O12S |
| Molecular Weight | 909.28 g/mol |
| Exact Mass | 908.57 |
| IUPAC Name | [1-[3,5-dihydroxy-6-(hydroxymethyl)-4-sulfooxyoxan-2-yl]oxy-3-[(8Z,11Z,14Z,17Z,20Z,23Z)-hexacosa-8,11,14,17,20,23-hexaenoxy]propan-2-yl] (Z)-pentadec-9-enoate |
| SMILES | CC/C=C\C/C=C\C/C=C\C/C=C\C/C=C\C/C=C\CCCCCCCOCC(COC1OC(CO)C(O)C(OS(=O)(=O)O)C1O)OC(=O)CCCCCCC/C=C\CCCCC |
| InChI | InChI=1S/C50H84O12S/c1-3-5-7-9-11-13-15-17-18-19-20-21-22-23-24-25-26-27-28-30-32-34-36-38-40-58-42-44(60-46(52)39-37-35-33-31-29-16-14-12-10-8-6-4-2)43-59-50-48(54)49(62-63(55,56)57)47(53)45(41-51)61-50/h5,7,11-14,17-18,20-21,23-24,26-27,44-45,47-51,53-54H,3-4,6,8-10,15-16,19,22,25,28-43H2,1-2H3,(H,55,56,57)/b7-5-,13-11-,14-12-,18-17-,21-20-,24-23-,27-26- |
| InChIKey | NEUKLALYUIEOPS-JSQURJFFSA-N |
| XLogP | 10.46 |
| TPSA | 178.28 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 40 |
| Heavy Atoms | 63 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 909.28 |
| LogP ≤ 5 | 10.46 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|