C52H93NO7P+ — CID 165274382
2-[hydroxy-[3-[(Z)-icos-11-enoxy]-2-[(6Z,9Z,12Z,15Z,18Z,21Z)-tetracosa-6,9,12,15,18,21-hexaenoyl]oxypropoxy]phosphoryl]oxyethyl-trimethylazanium (PubChem CID 165274382) has the molecular formula C52H93NO7P+ and a molecular weight of 875.29 g/mol. Its IUPAC name is 2-[hydroxy-[3-[(Z)-icos-11-enoxy]-2-[(6Z,9Z,12Z,15Z,18Z,21Z)-tetracosa-6,9,12,15,18,21-hexaenoyl]oxypropoxy]phosphoryl]oxyethyl-trimethylazanium.
| Compound Name | 2-[hydroxy-[3-[(Z)-icos-11-enoxy]-2-[(6Z,9Z,12Z,15Z,18Z,21Z)-tetracosa-6,9,12,15,18,21-hexaenoyl]oxypropoxy]phosphoryl]oxyethyl-trimethylazanium |
|---|---|
| PubChem CID | 165274382 |
| Molecular Formula | C52H93NO7P+ |
| Molecular Weight | 875.29 g/mol |
| Exact Mass | 874.67 |
| IUPAC Name | 2-[hydroxy-[3-[(Z)-icos-11-enoxy]-2-[(6Z,9Z,12Z,15Z,18Z,21Z)-tetracosa-6,9,12,15,18,21-hexaenoyl]oxypropoxy]phosphoryl]oxyethyl-trimethylazanium |
| SMILES | CC/C=C\C/C=C\C/C=C\C/C=C\C/C=C\C/C=C\CCCCC(=O)OC(COCCCCCCCCCC/C=C\CCCCCCCC)COP(=O)(O)OCC[N+](C)(C)C |
| InChI | InChI=1S/C52H92NO7P/c1-6-8-10-12-14-16-18-20-22-24-26-27-28-29-31-33-35-37-39-41-43-45-52(54)60-51(50-59-61(55,56)58-48-46-53(3,4)5)49-57-47-44-42-40-38-36-34-32-30-25-23-21-19-17-15-13-11-9-7-2/h8,10,14,16,20-23,26-27,29,31,35,37,51H,6-7,9,11-13,15,17-19,24-25,28,30,32-34,36,38-50H2,1-5H3/p+1/b10-8-,16-14-,22-20-,23-21-,27-26-,31-29-,37-35- |
| InChIKey | PITXGEBLSIYMFK-IVYXVQLVSA-O |
| XLogP | 14.83 |
| TPSA | 91.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 44 |
| Heavy Atoms | 61 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 875.29 |
| LogP ≤ 5 | 14.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|