C39H79NO7P+ — CID 165276752
2-[[2-decanoyloxy-3-[(Z)-henicos-11-enoxy]propoxy]-hydroxyphosphoryl]oxyethyl-trimethylazanium (PubChem CID 165276752) has the molecular formula C39H79NO7P+ and a molecular weight of 705.04 g/mol. Its IUPAC name is 2-[[2-decanoyloxy-3-[(Z)-henicos-11-enoxy]propoxy]-hydroxyphosphoryl]oxyethyl-trimethylazanium.
| Compound Name | 2-[[2-decanoyloxy-3-[(Z)-henicos-11-enoxy]propoxy]-hydroxyphosphoryl]oxyethyl-trimethylazanium |
|---|---|
| PubChem CID | 165276752 |
| Molecular Formula | C39H79NO7P+ |
| Molecular Weight | 705.04 g/mol |
| Exact Mass | 704.56 |
| IUPAC Name | 2-[[2-decanoyloxy-3-[(Z)-henicos-11-enoxy]propoxy]-hydroxyphosphoryl]oxyethyl-trimethylazanium |
| SMILES | CCCCCCCCC/C=C\CCCCCCCCCCOCC(COP(=O)(O)OCC[N+](C)(C)C)OC(=O)CCCCCCCCC |
| InChI | InChI=1S/C39H78NO7P/c1-6-8-10-12-14-15-16-17-18-19-20-21-22-23-24-25-27-29-31-34-44-36-38(37-46-48(42,43)45-35-33-40(3,4)5)47-39(41)32-30-28-26-13-11-9-7-2/h18-19,38H,6-17,20-37H2,1-5H3/p+1/b19-18- |
| InChIKey | PSCRJZKHWYEBGQ-HNENSFHCSA-O |
| XLogP | 11.10 |
| TPSA | 91.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 37 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 705.04 |
| LogP ≤ 5 | 11.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|