C34H52NO10P — CID 165285593
3-[(3-butanoyloxy-2-hydroxypropoxy)-hydroxyphosphoryl]oxy-2-[[(3Z,6Z,9Z,12Z,15Z,18Z,21Z)-tetracosa-3,6,9,12,15,18,21-heptaenoyl]amino]propanoic acid (PubChem CID 165285593) has the molecular formula C34H52NO10P and a molecular weight of 665.76 g/mol. Its IUPAC name is 3-[(3-butanoyloxy-2-hydroxypropoxy)-hydroxyphosphoryl]oxy-2-[[(3Z,6Z,9Z,12Z,15Z,18Z,21Z)-tetracosa-3,6,9,12,15,18,21-heptaenoyl]amino]propanoic acid.
| Compound Name | 3-[(3-butanoyloxy-2-hydroxypropoxy)-hydroxyphosphoryl]oxy-2-[[(3Z,6Z,9Z,12Z,15Z,18Z,21Z)-tetracosa-3,6,9,12,15,18,21-heptaenoyl]amino]propanoic acid |
|---|---|
| PubChem CID | 165285593 |
| Molecular Formula | C34H52NO10P |
| Molecular Weight | 665.76 g/mol |
| Exact Mass | 665.33 |
| IUPAC Name | 3-[(3-butanoyloxy-2-hydroxypropoxy)-hydroxyphosphoryl]oxy-2-[[(3Z,6Z,9Z,12Z,15Z,18Z,21Z)-tetracosa-3,6,9,12,15,18,21-heptaenoyl]amino]propanoic acid |
| SMILES | CC/C=C\C/C=C\C/C=C\C/C=C\C/C=C\C/C=C\C/C=C\CC(=O)NC(COP(=O)(O)OCC(O)COC(=O)CCC)C(=O)O |
| InChI | InChI=1S/C34H52NO10P/c1-3-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21-22-23-24-26-32(37)35-31(34(39)40)29-45-46(41,42)44-28-30(36)27-43-33(38)25-4-2/h5-6,8-9,11-12,14-15,17-18,20-21,23-24,30-31,36H,3-4,7,10,13,16,19,22,25-29H2,1-2H3,(H,35,37)(H,39,40)(H,41,42)/b6-5-,9-8-,12-11-,15-14-,18-17-,21-20-,24-23- |
| InChIKey | RAUZASJYRPEXHA-ZGPLAOMMSA-N |
| XLogP | 6.43 |
| TPSA | 168.69 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 27 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 665.76 |
| LogP ≤ 5 | 6.43 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|