C22H26ClNO7 — CID 16531166
4-O-[2-(2-chlorophenoxy)ethyl] 3-O,5-O-diethyl 2,6-dimethyl-1,4-dihydropyridine-3,4,5-tricarboxylate (PubChem CID 16531166) has the molecular formula C22H26ClNO7 and a molecular weight of 451.90 g/mol. Its IUPAC name is 4-O-[2-(2-chlorophenoxy)ethyl] 3-O,5-O-diethyl 2,6-dimethyl-1,4-dihydropyridine-3,4,5-tricarboxylate.
| Compound Name | 4-O-[2-(2-chlorophenoxy)ethyl] 3-O,5-O-diethyl 2,6-dimethyl-1,4-dihydropyridine-3,4,5-tricarboxylate |
|---|---|
| PubChem CID | 16531166 |
| Molecular Formula | C22H26ClNO7 |
| Molecular Weight | 451.90 g/mol |
| Exact Mass | 451.14 |
| IUPAC Name | 4-O-[2-(2-chlorophenoxy)ethyl] 3-O,5-O-diethyl 2,6-dimethyl-1,4-dihydropyridine-3,4,5-tricarboxylate |
| SMILES | CCOC(=O)C1=C(C)NC(C)=C(C(=O)OCC)C1C(=O)OCCOc1ccccc1Cl |
| InChI | InChI=1S/C22H26ClNO7/c1-5-28-20(25)17-13(3)24-14(4)18(21(26)29-6-2)19(17)22(27)31-12-11-30-16-10-8-7-9-15(16)23/h7-10,19,24H,5-6,11-12H2,1-4H3 |
| InChIKey | DDOHOFOECQICHX-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 100.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.90 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|