C24H29ClN2O7 — CID 3877335
4-O-[2-[2-(4-chlorophenyl)ethylamino]-2-oxoethyl] 3-O,5-O-diethyl 2,6-dimethyl-1,4-dihydropyridine-3,4,5-tricarboxylate (PubChem CID 3877335) has the molecular formula C24H29ClN2O7 and a molecular weight of 492.96 g/mol. Its IUPAC name is 4-O-[2-[2-(4-chlorophenyl)ethylamino]-2-oxoethyl] 3-O,5-O-diethyl 2,6-dimethyl-1,4-dihydropyridine-3,4,5-tricarboxylate.
| Compound Name | 4-O-[2-[2-(4-chlorophenyl)ethylamino]-2-oxoethyl] 3-O,5-O-diethyl 2,6-dimethyl-1,4-dihydropyridine-3,4,5-tricarboxylate |
|---|---|
| PubChem CID | 3877335 |
| Molecular Formula | C24H29ClN2O7 |
| Molecular Weight | 492.96 g/mol |
| Exact Mass | 492.17 |
| IUPAC Name | 4-O-[2-[2-(4-chlorophenyl)ethylamino]-2-oxoethyl] 3-O,5-O-diethyl 2,6-dimethyl-1,4-dihydropyridine-3,4,5-tricarboxylate |
| SMILES | CCOC(=O)C1=C(C)NC(C)=C(C(=O)OCC)C1C(=O)OCC(=O)NCCc1ccc(Cl)cc1 |
| InChI | InChI=1S/C24H29ClN2O7/c1-5-32-22(29)19-14(3)27-15(4)20(23(30)33-6-2)21(19)24(31)34-13-18(28)26-12-11-16-7-9-17(25)10-8-16/h7-10,21,27H,5-6,11-13H2,1-4H3,(H,26,28) |
| InChIKey | JTAFKFXXTLRAHZ-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 120.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.96 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|