C28H55NO7P+ — CID 165315172
2-[[3-[(9Z,12Z)-heptadeca-9,12-dienoxy]-2-propanoyloxypropoxy]-hydroxyphosphoryl]oxyethyl-trimethylazanium (PubChem CID 165315172) has the molecular formula C28H55NO7P+ and a molecular weight of 548.72 g/mol. Its IUPAC name is 2-[[3-[(9Z,12Z)-heptadeca-9,12-dienoxy]-2-propanoyloxypropoxy]-hydroxyphosphoryl]oxyethyl-trimethylazanium.
| Compound Name | 2-[[3-[(9Z,12Z)-heptadeca-9,12-dienoxy]-2-propanoyloxypropoxy]-hydroxyphosphoryl]oxyethyl-trimethylazanium |
|---|---|
| PubChem CID | 165315172 |
| Molecular Formula | C28H55NO7P+ |
| Molecular Weight | 548.72 g/mol |
| Exact Mass | 548.37 |
| IUPAC Name | 2-[[3-[(9Z,12Z)-heptadeca-9,12-dienoxy]-2-propanoyloxypropoxy]-hydroxyphosphoryl]oxyethyl-trimethylazanium |
| SMILES | CCCC/C=C\C/C=C\CCCCCCCCOCC(COP(=O)(O)OCC[N+](C)(C)C)OC(=O)CC |
| InChI | InChI=1S/C28H54NO7P/c1-6-8-9-10-11-12-13-14-15-16-17-18-19-20-21-23-33-25-27(36-28(30)7-2)26-35-37(31,32)34-24-22-29(3,4)5/h10-11,13-14,27H,6-9,12,15-26H2,1-5H3/p+1/b11-10-,14-13- |
| InChIKey | WHVVFVUXZMVUFK-XVTLYKPTSA-O |
| XLogP | 6.59 |
| TPSA | 91.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 25 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.72 |
| LogP ≤ 5 | 6.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|