C39H67NO7P+ — CID 165316287
2-[hydroxy-[3-[(7Z,10Z,13Z,16Z,19Z,22Z,25Z)-octacosa-7,10,13,16,19,22,25-heptaenoxy]-2-propanoyloxypropoxy]phosphoryl]oxyethyl-trimethylazanium (PubChem CID 165316287) has the molecular formula C39H67NO7P+ and a molecular weight of 692.94 g/mol. Its IUPAC name is 2-[hydroxy-[3-[(7Z,10Z,13Z,16Z,19Z,22Z,25Z)-octacosa-7,10,13,16,19,22,25-heptaenoxy]-2-propanoyloxypropoxy]phosphoryl]oxyethyl-trimethylazanium.
| Compound Name | 2-[hydroxy-[3-[(7Z,10Z,13Z,16Z,19Z,22Z,25Z)-octacosa-7,10,13,16,19,22,25-heptaenoxy]-2-propanoyloxypropoxy]phosphoryl]oxyethyl-trimethylazanium |
|---|---|
| PubChem CID | 165316287 |
| Molecular Formula | C39H67NO7P+ |
| Molecular Weight | 692.94 g/mol |
| Exact Mass | 692.46 |
| IUPAC Name | 2-[hydroxy-[3-[(7Z,10Z,13Z,16Z,19Z,22Z,25Z)-octacosa-7,10,13,16,19,22,25-heptaenoxy]-2-propanoyloxypropoxy]phosphoryl]oxyethyl-trimethylazanium |
| SMILES | CC/C=C\C/C=C\C/C=C\C/C=C\C/C=C\C/C=C\C/C=C\CCCCCCOCC(COP(=O)(O)OCC[N+](C)(C)C)OC(=O)CC |
| InChI | InChI=1S/C39H66NO7P/c1-6-8-9-10-11-12-13-14-15-16-17-18-19-20-21-22-23-24-25-26-27-28-29-30-31-32-34-44-36-38(47-39(41)7-2)37-46-48(42,43)45-35-33-40(3,4)5/h8-9,11-12,14-15,17-18,20-21,23-24,26-27,38H,6-7,10,13,16,19,22,25,28-37H2,1-5H3/p+1/b9-8-,12-11-,15-14-,18-17-,21-20-,24-23-,27-26- |
| InChIKey | WMLVFKHEEXPRQX-IBJYJKJLSA-O |
| XLogP | 9.76 |
| TPSA | 91.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 31 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 692.94 |
| LogP ≤ 5 | 9.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|