C43H73O12P — CID 165319088
[1-decoxy-3-[hydroxy-(2,3,4,5,6-pentahydroxycyclohexyl)oxyphosphoryl]oxypropan-2-yl] (6Z,9Z,12Z,15Z,18Z,21Z)-tetracosa-6,9,12,15,18,21-hexaenoate (PubChem CID 165319088) has the molecular formula C43H73O12P and a molecular weight of 813.02 g/mol. Its IUPAC name is [1-decoxy-3-[hydroxy-(2,3,4,5,6-pentahydroxycyclohexyl)oxyphosphoryl]oxypropan-2-yl] (6Z,9Z,12Z,15Z,18Z,21Z)-tetracosa-6,9,12,15,18,21-hexaenoate.
| Compound Name | [1-decoxy-3-[hydroxy-(2,3,4,5,6-pentahydroxycyclohexyl)oxyphosphoryl]oxypropan-2-yl] (6Z,9Z,12Z,15Z,18Z,21Z)-tetracosa-6,9,12,15,18,21-hexaenoate |
|---|---|
| PubChem CID | 165319088 |
| Molecular Formula | C43H73O12P |
| Molecular Weight | 813.02 g/mol |
| Exact Mass | 812.48 |
| IUPAC Name | [1-decoxy-3-[hydroxy-(2,3,4,5,6-pentahydroxycyclohexyl)oxyphosphoryl]oxypropan-2-yl] (6Z,9Z,12Z,15Z,18Z,21Z)-tetracosa-6,9,12,15,18,21-hexaenoate |
| SMILES | CC/C=C\C/C=C\C/C=C\C/C=C\C/C=C\C/C=C\CCCCC(=O)OC(COCCCCCCCCCC)COP(=O)(O)OC1C(O)C(O)C(O)C(O)C1O |
| InChI | InChI=1S/C43H73O12P/c1-3-5-7-9-11-13-14-15-16-17-18-19-20-21-22-23-24-25-26-28-30-32-37(44)54-36(34-52-33-31-29-27-12-10-8-6-4-2)35-53-56(50,51)55-43-41(48)39(46)38(45)40(47)42(43)49/h5,7,11,13,15-16,18-19,21-22,24-25,36,38-43,45-49H,3-4,6,8-10,12,14,17,20,23,26-35H2,1-2H3,(H,50,51)/b7-5-,13-11-,16-15-,19-18-,22-21-,25-24- |
| InChIKey | WXRWHNQKHKHZRY-GALCBNSZSA-N |
| XLogP | 7.63 |
| TPSA | 192.44 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 33 |
| Heavy Atoms | 56 |
| Complexity | — |
4 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 813.02 |
| LogP ≤ 5 | 7.63 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|