C51H87O12P — CID 165327133
[1-[(Z)-hexadec-9-enoxy]-3-[hydroxy-(2,3,4,5,6-pentahydroxycyclohexyl)oxyphosphoryl]oxypropan-2-yl] (8Z,11Z,14Z,17Z,20Z,23Z)-hexacosa-8,11,14,17,20,23-hexaenoate (PubChem CID 165327133) has the molecular formula C51H87O12P and a molecular weight of 923.22 g/mol. Its IUPAC name is [1-[(Z)-hexadec-9-enoxy]-3-[hydroxy-(2,3,4,5,6-pentahydroxycyclohexyl)oxyphosphoryl]oxypropan-2-yl] (8Z,11Z,14Z,17Z,20Z,23Z)-hexacosa-8,11,14,17,20,23-hexaenoate.
| Compound Name | [1-[(Z)-hexadec-9-enoxy]-3-[hydroxy-(2,3,4,5,6-pentahydroxycyclohexyl)oxyphosphoryl]oxypropan-2-yl] (8Z,11Z,14Z,17Z,20Z,23Z)-hexacosa-8,11,14,17,20,23-hexaenoate |
|---|---|
| PubChem CID | 165327133 |
| Molecular Formula | C51H87O12P |
| Molecular Weight | 923.22 g/mol |
| Exact Mass | 922.59 |
| IUPAC Name | [1-[(Z)-hexadec-9-enoxy]-3-[hydroxy-(2,3,4,5,6-pentahydroxycyclohexyl)oxyphosphoryl]oxypropan-2-yl] (8Z,11Z,14Z,17Z,20Z,23Z)-hexacosa-8,11,14,17,20,23-hexaenoate |
| SMILES | CC/C=C\C/C=C\C/C=C\C/C=C\C/C=C\C/C=C\CCCCCCC(=O)OC(COCCCCCCCC/C=C\CCCCCC)COP(=O)(O)OC1C(O)C(O)C(O)C(O)C1O |
| InChI | InChI=1S/C51H87O12P/c1-3-5-7-9-11-13-15-17-19-20-21-22-23-24-25-26-27-28-30-32-34-36-38-40-45(52)62-44(42-60-41-39-37-35-33-31-29-18-16-14-12-10-8-6-4-2)43-61-64(58,59)63-51-49(56)47(54)46(53)48(55)50(51)57/h5,7,11,13-14,16-17,19,21-22,24-25,27-28,44,46-51,53-57H,3-4,6,8-10,12,15,18,20,23,26,29-43H2,1-2H3,(H,58,59)/b7-5-,13-11-,16-14-,19-17-,22-21-,25-24-,28-27- |
| InChIKey | YDPJURCJDIPVNX-URKNVUPYSA-N |
| XLogP | 10.53 |
| TPSA | 192.44 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 40 |
| Heavy Atoms | 64 |
| Complexity | — |
4 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 923.22 |
| LogP ≤ 5 | 10.53 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|