C25H26N4O2S — CID 16532258
N-(1-cyanocyclohexyl)-2-[3-(4-methylphenyl)-4-oxoquinazolin-2-yl]sulfanylpropanamide (PubChem CID 16532258) has the molecular formula C25H26N4O2S and a molecular weight of 446.58 g/mol. Its IUPAC name is N-(1-cyanocyclohexyl)-2-[3-(4-methylphenyl)-4-oxoquinazolin-2-yl]sulfanylpropanamide.
| Compound Name | N-(1-cyanocyclohexyl)-2-[3-(4-methylphenyl)-4-oxoquinazolin-2-yl]sulfanylpropanamide |
|---|---|
| PubChem CID | 16532258 |
| Molecular Formula | C25H26N4O2S |
| Molecular Weight | 446.58 g/mol |
| Exact Mass | 446.18 |
| IUPAC Name | N-(1-cyanocyclohexyl)-2-[3-(4-methylphenyl)-4-oxoquinazolin-2-yl]sulfanylpropanamide |
| SMILES | Cc1ccc(-n2c(SC(C)C(=O)NC3(C#N)CCCCC3)nc3ccccc3c2=O)cc1 |
| InChI | InChI=1S/C25H26N4O2S/c1-17-10-12-19(13-11-17)29-23(31)20-8-4-5-9-21(20)27-24(29)32-18(2)22(30)28-25(16-26)14-6-3-7-15-25/h4-5,8-13,18H,3,6-7,14-15H2,1-2H3,(H,28,30) |
| InChIKey | QMBSNPKPJQJHNA-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 87.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.58 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |