C46H78O12S — CID 165330610
[1-[3,5-dihydroxy-6-(hydroxymethyl)-4-sulfooxyoxan-2-yl]oxy-3-[(Z)-pentadec-9-enoxy]propan-2-yl] (7Z,10Z,13Z,16Z,19Z)-docosa-7,10,13,16,19-pentaenoate (PubChem CID 165330610) has the molecular formula C46H78O12S and a molecular weight of 855.18 g/mol. Its IUPAC name is [1-[3,5-dihydroxy-6-(hydroxymethyl)-4-sulfooxyoxan-2-yl]oxy-3-[(Z)-pentadec-9-enoxy]propan-2-yl] (7Z,10Z,13Z,16Z,19Z)-docosa-7,10,13,16,19-pentaenoate.
| Compound Name | [1-[3,5-dihydroxy-6-(hydroxymethyl)-4-sulfooxyoxan-2-yl]oxy-3-[(Z)-pentadec-9-enoxy]propan-2-yl] (7Z,10Z,13Z,16Z,19Z)-docosa-7,10,13,16,19-pentaenoate |
|---|---|
| PubChem CID | 165330610 |
| Molecular Formula | C46H78O12S |
| Molecular Weight | 855.18 g/mol |
| Exact Mass | 854.52 |
| IUPAC Name | [1-[3,5-dihydroxy-6-(hydroxymethyl)-4-sulfooxyoxan-2-yl]oxy-3-[(Z)-pentadec-9-enoxy]propan-2-yl] (7Z,10Z,13Z,16Z,19Z)-docosa-7,10,13,16,19-pentaenoate |
| SMILES | CC/C=C\C/C=C\C/C=C\C/C=C\C/C=C\CCCCCC(=O)OC(COCCCCCCCC/C=C\CCCCC)COC1OC(CO)C(O)C(OS(=O)(=O)O)C1O |
| InChI | InChI=1S/C46H78O12S/c1-3-5-7-9-11-13-15-17-18-19-20-21-22-23-25-27-29-31-33-35-42(48)56-40(38-54-36-34-32-30-28-26-24-16-14-12-10-8-6-4-2)39-55-46-44(50)45(58-59(51,52)53)43(49)41(37-47)57-46/h5,7,11-14,17-18,20-21,23,25,40-41,43-47,49-50H,3-4,6,8-10,15-16,19,22,24,26-39H2,1-2H3,(H,51,52,53)/b7-5-,13-11-,14-12-,18-17-,21-20-,25-23- |
| InChIKey | YRHOWEAGLIEAMS-JHCUFIOSSA-N |
| XLogP | 9.13 |
| TPSA | 178.28 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 37 |
| Heavy Atoms | 59 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 855.18 |
| LogP ≤ 5 | 9.13 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|