C26H31NO6S — CID 16533984
[2-[butan-2-yl-(1,1-dioxothiolan-3-yl)amino]-2-oxoethyl] (E)-3-(2-methoxyphenyl)-2-phenylprop-2-enoate (PubChem CID 16533984) has the molecular formula C26H31NO6S and a molecular weight of 485.60 g/mol. Its IUPAC name is [2-[butan-2-yl-(1,1-dioxothiolan-3-yl)amino]-2-oxoethyl] (E)-3-(2-methoxyphenyl)-2-phenylprop-2-enoate.
| Compound Name | [2-[butan-2-yl-(1,1-dioxothiolan-3-yl)amino]-2-oxoethyl] (E)-3-(2-methoxyphenyl)-2-phenylprop-2-enoate |
|---|---|
| PubChem CID | 16533984 |
| Molecular Formula | C26H31NO6S |
| Molecular Weight | 485.60 g/mol |
| Exact Mass | 485.19 |
| IUPAC Name | [2-[butan-2-yl-(1,1-dioxothiolan-3-yl)amino]-2-oxoethyl] (E)-3-(2-methoxyphenyl)-2-phenylprop-2-enoate |
| SMILES | CCC(C)N(C(=O)COC(=O)/C(=C/c1ccccc1OC)c1ccccc1)C1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C26H31NO6S/c1-4-19(2)27(22-14-15-34(30,31)18-22)25(28)17-33-26(29)23(20-10-6-5-7-11-20)16-21-12-8-9-13-24(21)32-3/h5-13,16,19,22H,4,14-15,17-18H2,1-3H3/b23-16+ |
| InChIKey | YFANEGDCQYXXQM-XQNSMLJCSA-N |
| XLogP | 3.59 |
| TPSA | 89.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.60 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|