C23H25NO6S — CID 92945293
[2-[[(3S)-1,1-dioxothiolan-3-yl]-methylamino]-2-oxoethyl] (Z)-3-(3-methoxyphenyl)-2-phenylprop-2-enoate (PubChem CID 92945293) has the molecular formula C23H25NO6S and a molecular weight of 443.52 g/mol. Its IUPAC name is [2-[[(3S)-1,1-dioxothiolan-3-yl]-methylamino]-2-oxoethyl] (Z)-3-(3-methoxyphenyl)-2-phenylprop-2-enoate.
| Compound Name | [2-[[(3S)-1,1-dioxothiolan-3-yl]-methylamino]-2-oxoethyl] (Z)-3-(3-methoxyphenyl)-2-phenylprop-2-enoate |
|---|---|
| PubChem CID | 92945293 |
| Molecular Formula | C23H25NO6S |
| Molecular Weight | 443.52 g/mol |
| Exact Mass | 443.14 |
| IUPAC Name | [2-[[(3S)-1,1-dioxothiolan-3-yl]-methylamino]-2-oxoethyl] (Z)-3-(3-methoxyphenyl)-2-phenylprop-2-enoate |
| SMILES | COc1cccc(/C=C(\C(=O)OCC(=O)N(C)[C@H]2CCS(=O)(=O)C2)c2ccccc2)c1 |
| InChI | InChI=1S/C23H25NO6S/c1-24(19-11-12-31(27,28)16-19)22(25)15-30-23(26)21(18-8-4-3-5-9-18)14-17-7-6-10-20(13-17)29-2/h3-10,13-14,19H,11-12,15-16H2,1-2H3/b21-14-/t19-/m0/s1 |
| InChIKey | KJUYEMIXQQCOCM-BJLUOBIUSA-N |
| XLogP | 2.42 |
| TPSA | 89.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.52 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|