C23H25NO4 — CID 71953731
(2-oxo-2-piperidin-1-ylethyl) 3-(3-methoxyphenyl)-2-phenylprop-2-enoate (PubChem CID 71953731) has the molecular formula C23H25NO4 and a molecular weight of 379.46 g/mol. Its IUPAC name is (2-oxo-2-piperidin-1-ylethyl) 3-(3-methoxyphenyl)-2-phenylprop-2-enoate.
| Compound Name | (2-oxo-2-piperidin-1-ylethyl) 3-(3-methoxyphenyl)-2-phenylprop-2-enoate |
|---|---|
| PubChem CID | 71953731 |
| Molecular Formula | C23H25NO4 |
| Molecular Weight | 379.46 g/mol |
| Exact Mass | 379.18 |
| IUPAC Name | (2-oxo-2-piperidin-1-ylethyl) 3-(3-methoxyphenyl)-2-phenylprop-2-enoate |
| SMILES | COc1cccc(C=C(C(=O)OCC(=O)N2CCCCC2)c2ccccc2)c1 |
| InChI | InChI=1S/C23H25NO4/c1-27-20-12-8-9-18(15-20)16-21(19-10-4-2-5-11-19)23(26)28-17-22(25)24-13-6-3-7-14-24/h2,4-5,8-12,15-16H,3,6-7,13-14,17H2,1H3 |
| InChIKey | WJWTUMWCKSSKLR-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.46 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|