C26H33FO6 — CID 165340224
9-Fluoro-11beta,17-dihydroxy-16alpha-methyl-3,20-dioxopregna-1,4-dien-21-yl but-2-enoate (PubChem CID 165340224) has the molecular formula C26H33FO6 and a molecular weight of 460.50 g/mol. Its IUPAC name is [2-[(8S,9R,10S,11S,13S,14S,16R,17R)-9-fluoro-11,17-dihydroxy-10,13,16-trimethyl-3-oxo-6,7,8,11,12,14,15,16-octahydrocyclopenta[a]phenanthren-17-yl]-2-oxoethyl] but-2-enoate.
| Compound Name | 9-Fluoro-11beta,17-dihydroxy-16alpha-methyl-3,20-dioxopregna-1,4-dien-21-yl but-2-enoate |
|---|---|
| PubChem CID | 165340224 |
| Molecular Formula | C26H33FO6 |
| Molecular Weight | 460.50 g/mol |
| Exact Mass | 460.23 |
| IUPAC Name | [2-[(8S,9R,10S,11S,13S,14S,16R,17R)-9-fluoro-11,17-dihydroxy-10,13,16-trimethyl-3-oxo-6,7,8,11,12,14,15,16-octahydrocyclopenta[a]phenanthren-17-yl]-2-oxoethyl] but-2-enoate |
| SMILES | CC=CC(=O)OCC(=O)[C@]1([C@@H](C[C@@H]2[C@@]1(C[C@@H]([C@]3([C@H]2CCC4=CC(=O)C=C[C@@]43C)F)O)C)C)O |
| InChI | InChI=1S/C26H33FO6/c1-5-6-22(31)33-14-21(30)26(32)15(2)11-19-18-8-7-16-12-17(28)9-10-23(16,3)25(18,27)20(29)13-24(19,26)4/h5-6,9-10,12,15,18-20,29,32H,7-8,11,13-14H2,1-4H3/t15-,18+,19+,20+,23+,24+,25+,26+/m1/s1 |
| InChIKey | LHOWTXCKQMLBQS-QEAKFQLESA-N |
| XLogP | 3.60 |
| TPSA | 101.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | 983 |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.50 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|