C25H22Cl2N2O6S — CID 165341681
methyl 2-[[(2S)-1-(3,5-dichlorophenyl)sulfonylpyrrolidine-2-carbonyl]amino]-3-naphthalen-2-yl-3-oxopropanoate (PubChem CID 165341681) has the molecular formula C25H22Cl2N2O6S and a molecular weight of 549.43 g/mol. Its IUPAC name is methyl 2-[[(2S)-1-(3,5-dichlorophenyl)sulfonylpyrrolidine-2-carbonyl]amino]-3-naphthalen-2-yl-3-oxopropanoate.
| Compound Name | methyl 2-[[(2S)-1-(3,5-dichlorophenyl)sulfonylpyrrolidine-2-carbonyl]amino]-3-naphthalen-2-yl-3-oxopropanoate |
|---|---|
| PubChem CID | 165341681 |
| Molecular Formula | C25H22Cl2N2O6S |
| Molecular Weight | 549.43 g/mol |
| Exact Mass | 548.06 |
| IUPAC Name | methyl 2-[[(2S)-1-(3,5-dichlorophenyl)sulfonylpyrrolidine-2-carbonyl]amino]-3-naphthalen-2-yl-3-oxopropanoate |
| SMILES | COC(=O)C(NC(=O)[C@@H]1CCCN1S(=O)(=O)c1cc(Cl)cc(Cl)c1)C(=O)c1ccc2ccccc2c1 |
| InChI | InChI=1S/C25H22Cl2N2O6S/c1-35-25(32)22(23(30)17-9-8-15-5-2-3-6-16(15)11-17)28-24(31)21-7-4-10-29(21)36(33,34)20-13-18(26)12-19(27)14-20/h2-3,5-6,8-9,11-14,21-22H,4,7,10H2,1H3,(H,28,31)/t21-,22?/m0/s1 |
| InChIKey | PEUSEILXRIFLPS-HMTLIYDFSA-N |
| XLogP | 3.84 |
| TPSA | 109.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.43 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|