About 4-chloro-N-(4-methyl-5-sulfanylidene-1H-1,2,4-triazol-3-yl)benzamide
4-chloro-N-(4-methyl-5-sulfanylidene-1H-1,2,4-triazol-3-yl)benzamide (PubChem CID 165343781) has the molecular formula C10H9ClN4OS
and a molecular weight of 268.73 g/mol. Its IUPAC name is 4-chloro-N-(4-methyl-5-sulfanylidene-1H-1,2,4-triazol-3-yl)benzamide.
Molecular Properties
| Compound Name | 4-chloro-N-(4-methyl-5-sulfanylidene-1H-1,2,4-triazol-3-yl)benzamide |
| PubChem CID | 165343781 |
| Molecular Formula | C10H9ClN4OS |
| Molecular Weight | 268.73 g/mol |
| Exact Mass | 268.02 |
| IUPAC Name | 4-chloro-N-(4-methyl-5-sulfanylidene-1H-1,2,4-triazol-3-yl)benzamide |
| SMILES | Cn1c(NC(=O)c2ccc(Cl)cc2)n[nH]c1=S |
| InChI | InChI=1S/C10H9ClN4OS/c1-15-9(13-14-10(15)17)12-8(16)6-2-4-7(11)5-3-6/h2-5H,1H3,(H,14,17)(H,12,13,16) |
| InChIKey | FICWCOSKLLFNBR-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 62.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 268.73 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 4-chloro-N-(4-methyl-5-sulfanylidene-1H-1,2,4-triazol-3-yl)benzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-chloro-N-(4-methyl-5-sulfanylidene-1H-1,2,4-triazol-3-yl)benzamide?
The IUPAC name of 4-chloro-N-(4-methyl-5-sulfanylidene-1H-1,2,4-triazol-3-yl)benzamide (CID 165343781) is 4-chloro-N-(4-methyl-5-sulfanylidene-1H-1,2,4-triazol-3-yl)benzamide.
What is the SMILES notation for 4-chloro-N-(4-methyl-5-sulfanylidene-1H-1,2,4-triazol-3-yl)benzamide?
The canonical SMILES for 4-chloro-N-(4-methyl-5-sulfanylidene-1H-1,2,4-triazol-3-yl)benzamide is Cn1c(NC(=O)c2ccc(Cl)cc2)n[nH]c1=S.
What is the InChIKey of 4-chloro-N-(4-methyl-5-sulfanylidene-1H-1,2,4-triazol-3-yl)benzamide?
The InChIKey is FICWCOSKLLFNBR-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H9ClN4OS/c1-15-9(13-14-10(15)17)12-8(16)6-2-4-7(11)5-3-6/h2-5H,1H3,(H,14,17)(H,12,13,16).
What are the key properties of 4-chloro-N-(4-methyl-5-sulfanylidene-1H-1,2,4-triazol-3-yl)benzamide?
4-chloro-N-(4-methyl-5-sulfanylidene-1H-1,2,4-triazol-3-yl)benzamide has a molecular weight of 268.73 g/mol, XLogP of 2.38, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-chloro-N-(4-methyl-5-sulfanylidene-1H-1,2,4-triazol-3-yl)benzamide is sourced from PubChem (CID 165343781), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).