C10H9ClN4OS — CID 165343781
4-chloro-N-(4-methyl-5-sulfanylidene-1H-1,2,4-triazol-3-yl)benzamide (PubChem CID 165343781) has the molecular formula C10H9ClN4OS and a molecular weight of 268.73 g/mol. Its IUPAC name is 4-chloro-N-(4-methyl-5-sulfanylidene-1H-1,2,4-triazol-3-yl)benzamide.
| Compound Name | 4-chloro-N-(4-methyl-5-sulfanylidene-1H-1,2,4-triazol-3-yl)benzamide |
|---|---|
| PubChem CID | 165343781 |
| Molecular Formula | C10H9ClN4OS |
| Molecular Weight | 268.73 g/mol |
| Exact Mass | 268.02 |
| IUPAC Name | 4-chloro-N-(4-methyl-5-sulfanylidene-1H-1,2,4-triazol-3-yl)benzamide |
| SMILES | Cn1c(NC(=O)c2ccc(Cl)cc2)n[nH]c1=S |
| InChI | InChI=1S/C10H9ClN4OS/c1-15-9(13-14-10(15)17)12-8(16)6-2-4-7(11)5-3-6/h2-5H,1H3,(H,14,17)(H,12,13,16) |
| InChIKey | FICWCOSKLLFNBR-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 62.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.73 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|