C24H19Cl2N3O — CID 126744129
N-[4-benzyl-5-(4-chlorophenyl)-1-methylimidazol-2-yl]-4-chlorobenzamide (PubChem CID 126744129) has the molecular formula C24H19Cl2N3O and a molecular weight of 436.34 g/mol. Its IUPAC name is N-[4-benzyl-5-(4-chlorophenyl)-1-methylimidazol-2-yl]-4-chlorobenzamide.
| Compound Name | N-[4-benzyl-5-(4-chlorophenyl)-1-methylimidazol-2-yl]-4-chlorobenzamide |
|---|---|
| PubChem CID | 126744129 |
| Molecular Formula | C24H19Cl2N3O |
| Molecular Weight | 436.34 g/mol |
| Exact Mass | 435.09 |
| IUPAC Name | N-[4-benzyl-5-(4-chlorophenyl)-1-methylimidazol-2-yl]-4-chlorobenzamide |
| SMILES | Cn1c(NC(=O)c2ccc(Cl)cc2)nc(Cc2ccccc2)c1-c1ccc(Cl)cc1 |
| InChI | InChI=1S/C24H19Cl2N3O/c1-29-22(17-7-11-19(25)12-8-17)21(15-16-5-3-2-4-6-16)27-24(29)28-23(30)18-9-13-20(26)14-10-18/h2-14H,15H2,1H3,(H,27,28,30) |
| InChIKey | JPUDSEWZOKUNHP-UHFFFAOYSA-N |
| XLogP | 6.24 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.34 |
| LogP ≤ 5 | 6.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |