C25H22ClN3O2 — CID 135349193
N-[5-benzyl-4-(4-methoxyphenyl)-1-methylimidazol-2-yl]-4-chlorobenzamide (PubChem CID 135349193) has the molecular formula C25H22ClN3O2 and a molecular weight of 431.92 g/mol. Its IUPAC name is N-[5-benzyl-4-(4-methoxyphenyl)-1-methylimidazol-2-yl]-4-chlorobenzamide.
| Compound Name | N-[5-benzyl-4-(4-methoxyphenyl)-1-methylimidazol-2-yl]-4-chlorobenzamide |
|---|---|
| PubChem CID | 135349193 |
| Molecular Formula | C25H22ClN3O2 |
| Molecular Weight | 431.92 g/mol |
| Exact Mass | 431.14 |
| IUPAC Name | N-[5-benzyl-4-(4-methoxyphenyl)-1-methylimidazol-2-yl]-4-chlorobenzamide |
| SMILES | COc1ccc(-c2nc(NC(=O)c3ccc(Cl)cc3)n(C)c2Cc2ccccc2)cc1 |
| InChI | InChI=1S/C25H22ClN3O2/c1-29-22(16-17-6-4-3-5-7-17)23(18-10-14-21(31-2)15-11-18)27-25(29)28-24(30)19-8-12-20(26)13-9-19/h3-15H,16H2,1-2H3,(H,27,28,30) |
| InChIKey | PMBKMCWDHCSAQY-UHFFFAOYSA-N |
| XLogP | 5.59 |
| TPSA | 56.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.92 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |