C21H16ClN3O — CID 1111773
N-[1-[(4-chlorophenyl)methyl]benzimidazol-2-yl]benzamide (PubChem CID 1111773) has the molecular formula C21H16ClN3O and a molecular weight of 361.83 g/mol. Its IUPAC name is N-[1-[(4-chlorophenyl)methyl]benzimidazol-2-yl]benzamide.
| Compound Name | N-[1-[(4-chlorophenyl)methyl]benzimidazol-2-yl]benzamide |
|---|---|
| PubChem CID | 1111773 |
| Molecular Formula | C21H16ClN3O |
| Molecular Weight | 361.83 g/mol |
| Exact Mass | 361.10 |
| IUPAC Name | N-[1-[(4-chlorophenyl)methyl]benzimidazol-2-yl]benzamide |
| SMILES | O=C(Nc1nc2ccccc2n1Cc1ccc(Cl)cc1)c1ccccc1 |
| InChI | InChI=1S/C21H16ClN3O/c22-17-12-10-15(11-13-17)14-25-19-9-5-4-8-18(19)23-21(25)24-20(26)16-6-2-1-3-7-16/h1-13H,14H2,(H,23,24,26) |
| InChIKey | JPANQFIORHJURS-UHFFFAOYSA-N |
| XLogP | 4.99 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.83 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |