C26H27N3O — CID 16967343
N-[1-[1-[(4-propan-2-ylphenyl)methyl]benzimidazol-2-yl]ethyl]benzamide (PubChem CID 16967343) has the molecular formula C26H27N3O and a molecular weight of 397.52 g/mol. Its IUPAC name is N-[1-[1-[(4-propan-2-ylphenyl)methyl]benzimidazol-2-yl]ethyl]benzamide.
| Compound Name | N-[1-[1-[(4-propan-2-ylphenyl)methyl]benzimidazol-2-yl]ethyl]benzamide |
|---|---|
| PubChem CID | 16967343 |
| Molecular Formula | C26H27N3O |
| Molecular Weight | 397.52 g/mol |
| Exact Mass | 397.22 |
| IUPAC Name | N-[1-[1-[(4-propan-2-ylphenyl)methyl]benzimidazol-2-yl]ethyl]benzamide |
| SMILES | CC(C)c1ccc(Cn2c(C(C)NC(=O)c3ccccc3)nc3ccccc32)cc1 |
| InChI | InChI=1S/C26H27N3O/c1-18(2)21-15-13-20(14-16-21)17-29-24-12-8-7-11-23(24)28-25(29)19(3)27-26(30)22-9-5-4-6-10-22/h4-16,18-19H,17H2,1-3H3,(H,27,30) |
| InChIKey | QKFWGEPHBOVWFZ-UHFFFAOYSA-N |
| XLogP | 5.70 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.52 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |