C26H33N3O — CID 16968280
N-[1-[1-[(4-propan-2-ylphenyl)methyl]benzimidazol-2-yl]ethyl]cyclohexanecarboxamide (PubChem CID 16968280) has the molecular formula C26H33N3O and a molecular weight of 403.57 g/mol. Its IUPAC name is N-[1-[1-[(4-propan-2-ylphenyl)methyl]benzimidazol-2-yl]ethyl]cyclohexanecarboxamide.
| Compound Name | N-[1-[1-[(4-propan-2-ylphenyl)methyl]benzimidazol-2-yl]ethyl]cyclohexanecarboxamide |
|---|---|
| PubChem CID | 16968280 |
| Molecular Formula | C26H33N3O |
| Molecular Weight | 403.57 g/mol |
| Exact Mass | 403.26 |
| IUPAC Name | N-[1-[1-[(4-propan-2-ylphenyl)methyl]benzimidazol-2-yl]ethyl]cyclohexanecarboxamide |
| SMILES | CC(C)c1ccc(Cn2c(C(C)NC(=O)C3CCCCC3)nc3ccccc32)cc1 |
| InChI | InChI=1S/C26H33N3O/c1-18(2)21-15-13-20(14-16-21)17-29-24-12-8-7-11-23(24)28-25(29)19(3)27-26(30)22-9-5-4-6-10-22/h7-8,11-16,18-19,22H,4-6,9-10,17H2,1-3H3,(H,27,30) |
| InChIKey | LFGWENFGNQPIHH-UHFFFAOYSA-N |
| XLogP | 5.97 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.57 |
| LogP ≤ 5 | 5.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |