C27H35N3O — CID 16968279
N-[1-[1-[(4-tert-butylphenyl)methyl]benzimidazol-2-yl]ethyl]cyclohexanecarboxamide (PubChem CID 16968279) has the molecular formula C27H35N3O and a molecular weight of 417.60 g/mol. Its IUPAC name is N-[1-[1-[(4-tert-butylphenyl)methyl]benzimidazol-2-yl]ethyl]cyclohexanecarboxamide.
| Compound Name | N-[1-[1-[(4-tert-butylphenyl)methyl]benzimidazol-2-yl]ethyl]cyclohexanecarboxamide |
|---|---|
| PubChem CID | 16968279 |
| Molecular Formula | C27H35N3O |
| Molecular Weight | 417.60 g/mol |
| Exact Mass | 417.28 |
| IUPAC Name | N-[1-[1-[(4-tert-butylphenyl)methyl]benzimidazol-2-yl]ethyl]cyclohexanecarboxamide |
| SMILES | CC(NC(=O)C1CCCCC1)c1nc2ccccc2n1Cc1ccc(C(C)(C)C)cc1 |
| InChI | InChI=1S/C27H35N3O/c1-19(28-26(31)21-10-6-5-7-11-21)25-29-23-12-8-9-13-24(23)30(25)18-20-14-16-22(17-15-20)27(2,3)4/h8-9,12-17,19,21H,5-7,10-11,18H2,1-4H3,(H,28,31) |
| InChIKey | KWDKKSGCHARMBI-UHFFFAOYSA-N |
| XLogP | 6.14 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.60 |
| LogP ≤ 5 | 6.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |