C22H27N3O — CID 16968118
N-[1-[1-[(4-tert-butylphenyl)methyl]benzimidazol-2-yl]ethyl]acetamide (PubChem CID 16968118) has the molecular formula C22H27N3O and a molecular weight of 349.48 g/mol. Its IUPAC name is N-[1-[1-[(4-tert-butylphenyl)methyl]benzimidazol-2-yl]ethyl]acetamide.
| Compound Name | N-[1-[1-[(4-tert-butylphenyl)methyl]benzimidazol-2-yl]ethyl]acetamide |
|---|---|
| PubChem CID | 16968118 |
| Molecular Formula | C22H27N3O |
| Molecular Weight | 349.48 g/mol |
| Exact Mass | 349.22 |
| IUPAC Name | N-[1-[1-[(4-tert-butylphenyl)methyl]benzimidazol-2-yl]ethyl]acetamide |
| SMILES | CC(=O)NC(C)c1nc2ccccc2n1Cc1ccc(C(C)(C)C)cc1 |
| InChI | InChI=1S/C22H27N3O/c1-15(23-16(2)26)21-24-19-8-6-7-9-20(19)25(21)14-17-10-12-18(13-11-17)22(3,4)5/h6-13,15H,14H2,1-5H3,(H,23,26) |
| InChIKey | HOERSWJAUKWAAB-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.48 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |