C28H31N3O — CID 16967041
N-[1-[1-[(4-tert-butylphenyl)methyl]benzimidazol-2-yl]ethyl]-3-methylbenzamide (PubChem CID 16967041) has the molecular formula C28H31N3O and a molecular weight of 425.58 g/mol. Its IUPAC name is N-[1-[1-[(4-tert-butylphenyl)methyl]benzimidazol-2-yl]ethyl]-3-methylbenzamide.
| Compound Name | N-[1-[1-[(4-tert-butylphenyl)methyl]benzimidazol-2-yl]ethyl]-3-methylbenzamide |
|---|---|
| PubChem CID | 16967041 |
| Molecular Formula | C28H31N3O |
| Molecular Weight | 425.58 g/mol |
| Exact Mass | 425.25 |
| IUPAC Name | N-[1-[1-[(4-tert-butylphenyl)methyl]benzimidazol-2-yl]ethyl]-3-methylbenzamide |
| SMILES | Cc1cccc(C(=O)NC(C)c2nc3ccccc3n2Cc2ccc(C(C)(C)C)cc2)c1 |
| InChI | InChI=1S/C28H31N3O/c1-19-9-8-10-22(17-19)27(32)29-20(2)26-30-24-11-6-7-12-25(24)31(26)18-21-13-15-23(16-14-21)28(3,4)5/h6-17,20H,18H2,1-5H3,(H,29,32) |
| InChIKey | TUKYLRZZFGQLDC-UHFFFAOYSA-N |
| XLogP | 6.18 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.58 |
| LogP ≤ 5 | 6.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |