C23H28N4O2 — CID 16967131
N-[1-[1-[2-(diethylamino)-2-oxoethyl]benzimidazol-2-yl]ethyl]-3-methylbenzamide (PubChem CID 16967131) has the molecular formula C23H28N4O2 and a molecular weight of 392.50 g/mol. Its IUPAC name is N-[1-[1-[2-(diethylamino)-2-oxoethyl]benzimidazol-2-yl]ethyl]-3-methylbenzamide.
| Compound Name | N-[1-[1-[2-(diethylamino)-2-oxoethyl]benzimidazol-2-yl]ethyl]-3-methylbenzamide |
|---|---|
| PubChem CID | 16967131 |
| Molecular Formula | C23H28N4O2 |
| Molecular Weight | 392.50 g/mol |
| Exact Mass | 392.22 |
| IUPAC Name | N-[1-[1-[2-(diethylamino)-2-oxoethyl]benzimidazol-2-yl]ethyl]-3-methylbenzamide |
| SMILES | CCN(CC)C(=O)Cn1c(C(C)NC(=O)c2cccc(C)c2)nc2ccccc21 |
| InChI | InChI=1S/C23H28N4O2/c1-5-26(6-2)21(28)15-27-20-13-8-7-12-19(20)25-22(27)17(4)24-23(29)18-11-9-10-16(3)14-18/h7-14,17H,5-6,15H2,1-4H3,(H,24,29) |
| InChIKey | WCBJZJZIIPNYKJ-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 67.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.50 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |