C24H29BrN4O2 — CID 17010377
3-bromo-N-[1-[1-[2-[di(propan-2-yl)amino]-2-oxoethyl]benzimidazol-2-yl]ethyl]benzamide (PubChem CID 17010377) has the molecular formula C24H29BrN4O2 and a molecular weight of 485.43 g/mol. Its IUPAC name is 3-bromo-N-[1-[1-[2-[di(propan-2-yl)amino]-2-oxoethyl]benzimidazol-2-yl]ethyl]benzamide.
| Compound Name | 3-bromo-N-[1-[1-[2-[di(propan-2-yl)amino]-2-oxoethyl]benzimidazol-2-yl]ethyl]benzamide |
|---|---|
| PubChem CID | 17010377 |
| Molecular Formula | C24H29BrN4O2 |
| Molecular Weight | 485.43 g/mol |
| Exact Mass | 484.15 |
| IUPAC Name | 3-bromo-N-[1-[1-[2-[di(propan-2-yl)amino]-2-oxoethyl]benzimidazol-2-yl]ethyl]benzamide |
| SMILES | CC(NC(=O)c1cccc(Br)c1)c1nc2ccccc2n1CC(=O)N(C(C)C)C(C)C |
| InChI | InChI=1S/C24H29BrN4O2/c1-15(2)29(16(3)4)22(30)14-28-21-12-7-6-11-20(21)27-23(28)17(5)26-24(31)18-9-8-10-19(25)13-18/h6-13,15-17H,14H2,1-5H3,(H,26,31) |
| InChIKey | VIVNFZAAUIJGKH-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 67.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.43 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |