C24H22BrN3O — CID 17010269
3-bromo-N-[1-[1-[(2-methylphenyl)methyl]benzimidazol-2-yl]ethyl]benzamide (PubChem CID 17010269) has the molecular formula C24H22BrN3O and a molecular weight of 448.36 g/mol. Its IUPAC name is 3-bromo-N-[1-[1-[(2-methylphenyl)methyl]benzimidazol-2-yl]ethyl]benzamide.
| Compound Name | 3-bromo-N-[1-[1-[(2-methylphenyl)methyl]benzimidazol-2-yl]ethyl]benzamide |
|---|---|
| PubChem CID | 17010269 |
| Molecular Formula | C24H22BrN3O |
| Molecular Weight | 448.36 g/mol |
| Exact Mass | 447.09 |
| IUPAC Name | 3-bromo-N-[1-[1-[(2-methylphenyl)methyl]benzimidazol-2-yl]ethyl]benzamide |
| SMILES | Cc1ccccc1Cn1c(C(C)NC(=O)c2cccc(Br)c2)nc2ccccc21 |
| InChI | InChI=1S/C24H22BrN3O/c1-16-8-3-4-9-19(16)15-28-22-13-6-5-12-21(22)27-23(28)17(2)26-24(29)18-10-7-11-20(25)14-18/h3-14,17H,15H2,1-2H3,(H,26,29) |
| InChIKey | QTVHLLAYDKSONR-UHFFFAOYSA-N |
| XLogP | 5.65 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.36 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |