C23H29N3O — CID 16969021
2-ethyl-N-[1-[1-[(2-methylphenyl)methyl]benzimidazol-2-yl]ethyl]butanamide (PubChem CID 16969021) has the molecular formula C23H29N3O and a molecular weight of 363.50 g/mol. Its IUPAC name is 2-ethyl-N-[1-[1-[(2-methylphenyl)methyl]benzimidazol-2-yl]ethyl]butanamide.
| Compound Name | 2-ethyl-N-[1-[1-[(2-methylphenyl)methyl]benzimidazol-2-yl]ethyl]butanamide |
|---|---|
| PubChem CID | 16969021 |
| Molecular Formula | C23H29N3O |
| Molecular Weight | 363.50 g/mol |
| Exact Mass | 363.23 |
| IUPAC Name | 2-ethyl-N-[1-[1-[(2-methylphenyl)methyl]benzimidazol-2-yl]ethyl]butanamide |
| SMILES | CCC(CC)C(=O)NC(C)c1nc2ccccc2n1Cc1ccccc1C |
| InChI | InChI=1S/C23H29N3O/c1-5-18(6-2)23(27)24-17(4)22-25-20-13-9-10-14-21(20)26(22)15-19-12-8-7-11-16(19)3/h7-14,17-18H,5-6,15H2,1-4H3,(H,24,27) |
| InChIKey | VJHYWHLEQIISGQ-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.50 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |