C25H25N3O — CID 16967026
3-methyl-N-[1-[1-[(2-methylphenyl)methyl]benzimidazol-2-yl]ethyl]benzamide (PubChem CID 16967026) has the molecular formula C25H25N3O and a molecular weight of 383.50 g/mol. Its IUPAC name is 3-methyl-N-[1-[1-[(2-methylphenyl)methyl]benzimidazol-2-yl]ethyl]benzamide.
| Compound Name | 3-methyl-N-[1-[1-[(2-methylphenyl)methyl]benzimidazol-2-yl]ethyl]benzamide |
|---|---|
| PubChem CID | 16967026 |
| Molecular Formula | C25H25N3O |
| Molecular Weight | 383.50 g/mol |
| Exact Mass | 383.20 |
| IUPAC Name | 3-methyl-N-[1-[1-[(2-methylphenyl)methyl]benzimidazol-2-yl]ethyl]benzamide |
| SMILES | Cc1cccc(C(=O)NC(C)c2nc3ccccc3n2Cc2ccccc2C)c1 |
| InChI | InChI=1S/C25H25N3O/c1-17-9-8-12-20(15-17)25(29)26-19(3)24-27-22-13-6-7-14-23(22)28(24)16-21-11-5-4-10-18(21)2/h4-15,19H,16H2,1-3H3,(H,26,29) |
| InChIKey | CFYMYYBFBKEZCQ-UHFFFAOYSA-N |
| XLogP | 5.19 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.50 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |