C24H29N3O — CID 16968262
N-[1-[1-[(2-methylphenyl)methyl]benzimidazol-2-yl]ethyl]cyclohexanecarboxamide (PubChem CID 16968262) has the molecular formula C24H29N3O and a molecular weight of 375.52 g/mol. Its IUPAC name is N-[1-[1-[(2-methylphenyl)methyl]benzimidazol-2-yl]ethyl]cyclohexanecarboxamide.
| Compound Name | N-[1-[1-[(2-methylphenyl)methyl]benzimidazol-2-yl]ethyl]cyclohexanecarboxamide |
|---|---|
| PubChem CID | 16968262 |
| Molecular Formula | C24H29N3O |
| Molecular Weight | 375.52 g/mol |
| Exact Mass | 375.23 |
| IUPAC Name | N-[1-[1-[(2-methylphenyl)methyl]benzimidazol-2-yl]ethyl]cyclohexanecarboxamide |
| SMILES | Cc1ccccc1Cn1c(C(C)NC(=O)C2CCCCC2)nc2ccccc21 |
| InChI | InChI=1S/C24H29N3O/c1-17-10-6-7-13-20(17)16-27-22-15-9-8-14-21(22)26-23(27)18(2)25-24(28)19-11-4-3-5-12-19/h6-10,13-15,18-19H,3-5,11-12,16H2,1-2H3,(H,25,28) |
| InChIKey | OLFZRKPITKYXPS-UHFFFAOYSA-N |
| XLogP | 5.15 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.52 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |