C23H19Cl2N3O — CID 40910160
N-[(1S)-1-[1-[(2,6-dichlorophenyl)methyl]benzimidazol-2-yl]ethyl]benzamide (PubChem CID 40910160) has the molecular formula C23H19Cl2N3O and a molecular weight of 424.33 g/mol. Its IUPAC name is N-[(1S)-1-[1-[(2,6-dichlorophenyl)methyl]benzimidazol-2-yl]ethyl]benzamide.
| Compound Name | N-[(1S)-1-[1-[(2,6-dichlorophenyl)methyl]benzimidazol-2-yl]ethyl]benzamide |
|---|---|
| PubChem CID | 40910160 |
| Molecular Formula | C23H19Cl2N3O |
| Molecular Weight | 424.33 g/mol |
| Exact Mass | 423.09 |
| IUPAC Name | N-[(1S)-1-[1-[(2,6-dichlorophenyl)methyl]benzimidazol-2-yl]ethyl]benzamide |
| SMILES | C[C@H](NC(=O)c1ccccc1)c1nc2ccccc2n1Cc1c(Cl)cccc1Cl |
| InChI | InChI=1S/C23H19Cl2N3O/c1-15(26-23(29)16-8-3-2-4-9-16)22-27-20-12-5-6-13-21(20)28(22)14-17-18(24)10-7-11-19(17)25/h2-13,15H,14H2,1H3,(H,26,29)/t15-/m0/s1 |
| InChIKey | GGIUEWIUBMISMD-HNNXBMFYSA-N |
| XLogP | 5.88 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.33 |
| LogP ≤ 5 | 5.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |