C23H19ClFN3O — CID 17009491
4-chloro-N-[1-[1-[(4-fluorophenyl)methyl]benzimidazol-2-yl]ethyl]benzamide (PubChem CID 17009491) has the molecular formula C23H19ClFN3O and a molecular weight of 407.88 g/mol. Its IUPAC name is 4-chloro-N-[1-[1-[(4-fluorophenyl)methyl]benzimidazol-2-yl]ethyl]benzamide.
| Compound Name | 4-chloro-N-[1-[1-[(4-fluorophenyl)methyl]benzimidazol-2-yl]ethyl]benzamide |
|---|---|
| PubChem CID | 17009491 |
| Molecular Formula | C23H19ClFN3O |
| Molecular Weight | 407.88 g/mol |
| Exact Mass | 407.12 |
| IUPAC Name | 4-chloro-N-[1-[1-[(4-fluorophenyl)methyl]benzimidazol-2-yl]ethyl]benzamide |
| SMILES | CC(NC(=O)c1ccc(Cl)cc1)c1nc2ccccc2n1Cc1ccc(F)cc1 |
| InChI | InChI=1S/C23H19ClFN3O/c1-15(26-23(29)17-8-10-18(24)11-9-17)22-27-20-4-2-3-5-21(20)28(22)14-16-6-12-19(25)13-7-16/h2-13,15H,14H2,1H3,(H,26,29) |
| InChIKey | XRVDEMKZWFLULW-UHFFFAOYSA-N |
| XLogP | 5.37 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.88 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |