C19H18FN3O — CID 751224
4-fluoro-N-[(1S)-1-(1-prop-2-enylbenzimidazol-2-yl)ethyl]benzamide (PubChem CID 751224) has the molecular formula C19H18FN3O and a molecular weight of 323.37 g/mol. Its IUPAC name is 4-fluoro-N-[(1S)-1-(1-prop-2-enylbenzimidazol-2-yl)ethyl]benzamide.
| Compound Name | 4-fluoro-N-[(1S)-1-(1-prop-2-enylbenzimidazol-2-yl)ethyl]benzamide |
|---|---|
| PubChem CID | 751224 |
| Molecular Formula | C19H18FN3O |
| Molecular Weight | 323.37 g/mol |
| Exact Mass | 323.14 |
| IUPAC Name | 4-fluoro-N-[(1S)-1-(1-prop-2-enylbenzimidazol-2-yl)ethyl]benzamide |
| SMILES | C=CCn1c([C@H](C)NC(=O)c2ccc(F)cc2)nc2ccccc21 |
| InChI | InChI=1S/C19H18FN3O/c1-3-12-23-17-7-5-4-6-16(17)22-18(23)13(2)21-19(24)14-8-10-15(20)11-9-14/h3-11,13H,1,12H2,2H3,(H,21,24)/t13-/m0/s1 |
| InChIKey | AZLLCIQRBNXFIK-ZDUSSCGKSA-N |
| XLogP | 3.85 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.37 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|