C17H14Cl2N2 — CID 165343790
3-chloro-N-[5-(3-chlorophenyl)iminopenta-1,3-dienyl]aniline (PubChem CID 165343790) has the molecular formula C17H14Cl2N2 and a molecular weight of 317.22 g/mol. Its IUPAC name is 3-chloro-N-[5-(3-chlorophenyl)iminopenta-1,3-dienyl]aniline.
| Compound Name | 3-chloro-N-[5-(3-chlorophenyl)iminopenta-1,3-dienyl]aniline |
|---|---|
| PubChem CID | 165343790 |
| Molecular Formula | C17H14Cl2N2 |
| Molecular Weight | 317.22 g/mol |
| Exact Mass | 316.05 |
| IUPAC Name | 3-chloro-N-[5-(3-chlorophenyl)iminopenta-1,3-dienyl]aniline |
| SMILES | Clc1cccc(/N=C/C=CC=CNc2cccc(Cl)c2)c1 |
| InChI | InChI=1S/C17H14Cl2N2/c18-14-6-4-8-16(12-14)20-10-2-1-3-11-21-17-9-5-7-15(19)13-17/h1-13,20H/b3-1?,10-2?,21-11+ |
| InChIKey | WWFWJFLQSDOYRP-SIKOGCHYSA-N |
| XLogP | 5.88 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.22 |
| LogP ≤ 5 | 5.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|