C17H15NO3 — CID 165351417
(5S,6S)-6-phenoxy-5-phenyl-4-oxa-1-azabicyclo[3.2.0]heptan-7-one (PubChem CID 165351417) has the molecular formula C17H15NO3 and a molecular weight of 281.31 g/mol. Its IUPAC name is (5S,6S)-6-phenoxy-5-phenyl-4-oxa-1-azabicyclo[3.2.0]heptan-7-one.
| Compound Name | (5S,6S)-6-phenoxy-5-phenyl-4-oxa-1-azabicyclo[3.2.0]heptan-7-one |
|---|---|
| PubChem CID | 165351417 |
| Molecular Formula | C17H15NO3 |
| Molecular Weight | 281.31 g/mol |
| Exact Mass | 281.11 |
| IUPAC Name | (5S,6S)-6-phenoxy-5-phenyl-4-oxa-1-azabicyclo[3.2.0]heptan-7-one |
| SMILES | O=C1[C@@H](Oc2ccccc2)[C@]2(c3ccccc3)OCCN12 |
| InChI | InChI=1S/C17H15NO3/c19-16-15(21-14-9-5-2-6-10-14)17(18(16)11-12-20-17)13-7-3-1-4-8-13/h1-10,15H,11-12H2/t15-,17+/m1/s1 |
| InChIKey | SCOBMBJLZIEQLN-WBVHZDCISA-N |
| XLogP | 2.16 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.31 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |