C27H26Cl2N2O2 — CID 12509593
9b-[4-[bis(2-chloroethyl)amino]phenyl]-1-phenoxy-4,5-dihydro-1H-azeto[2,1-a]isoquinolin-2-one (PubChem CID 12509593) has the molecular formula C27H26Cl2N2O2 and a molecular weight of 481.42 g/mol. Its IUPAC name is 9b-[4-[bis(2-chloroethyl)amino]phenyl]-1-phenoxy-4,5-dihydro-1H-azeto[2,1-a]isoquinolin-2-one.
| Compound Name | 9b-[4-[bis(2-chloroethyl)amino]phenyl]-1-phenoxy-4,5-dihydro-1H-azeto[2,1-a]isoquinolin-2-one |
|---|---|
| PubChem CID | 12509593 |
| Molecular Formula | C27H26Cl2N2O2 |
| Molecular Weight | 481.42 g/mol |
| Exact Mass | 480.14 |
| IUPAC Name | 9b-[4-[bis(2-chloroethyl)amino]phenyl]-1-phenoxy-4,5-dihydro-1H-azeto[2,1-a]isoquinolin-2-one |
| SMILES | O=C1C(Oc2ccccc2)C2(c3ccc(N(CCCl)CCCl)cc3)c3ccccc3CCN12 |
| InChI | InChI=1S/C27H26Cl2N2O2/c28-15-18-30(19-16-29)22-12-10-21(11-13-22)27-24-9-5-4-6-20(24)14-17-31(27)26(32)25(27)33-23-7-2-1-3-8-23/h1-13,25H,14-19H2 |
| InChIKey | AMFOPUOOURHHIM-UHFFFAOYSA-N |
| XLogP | 5.06 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.42 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|