C19H23NO5 — CID 165355008
N-methyl-1-(2,3,6,7-tetramethoxy-9H-xanthen-9-yl)methanamine (PubChem CID 165355008) has the molecular formula C19H23NO5 and a molecular weight of 345.40 g/mol. Its IUPAC name is N-methyl-1-(2,3,6,7-tetramethoxy-9H-xanthen-9-yl)methanamine.
| Compound Name | N-methyl-1-(2,3,6,7-tetramethoxy-9H-xanthen-9-yl)methanamine |
|---|---|
| PubChem CID | 165355008 |
| Molecular Formula | C19H23NO5 |
| Molecular Weight | 345.40 g/mol |
| Exact Mass | 345.16 |
| IUPAC Name | N-methyl-1-(2,3,6,7-tetramethoxy-9H-xanthen-9-yl)methanamine |
| SMILES | CNCC1c2cc(OC)c(OC)cc2Oc2cc(OC)c(OC)cc21 |
| InChI | InChI=1S/C19H23NO5/c1-20-10-13-11-6-16(21-2)18(23-4)8-14(11)25-15-9-19(24-5)17(22-3)7-12(13)15/h6-9,13,20H,10H2,1-5H3 |
| InChIKey | NDYLBZDXQOPLAY-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 58.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.40 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |