About 2,3-dimethoxy-5,6-dihydrobenzo[b][1]benzoxepin-5-ol
2,3-dimethoxy-5,6-dihydrobenzo[b][1]benzoxepin-5-ol (PubChem CID 134869505) has the molecular formula C16H16O4
and a molecular weight of 272.30 g/mol. Its IUPAC name is 2,3-dimethoxy-5,6-dihydrobenzo[b][1]benzoxepin-5-ol.
Molecular Properties
| Compound Name | 2,3-dimethoxy-5,6-dihydrobenzo[b][1]benzoxepin-5-ol |
| PubChem CID | 134869505 |
| Molecular Formula | C16H16O4 |
| Molecular Weight | 272.30 g/mol |
| Exact Mass | 272.10 |
| IUPAC Name | 2,3-dimethoxy-5,6-dihydrobenzo[b][1]benzoxepin-5-ol |
| SMILES | COc1cc2c(cc1OC)C(O)Cc1ccccc1O2 |
| InChI | InChI=1S/C16H16O4/c1-18-15-8-11-12(17)7-10-5-3-4-6-13(10)20-14(11)9-16(15)19-2/h3-6,8-9,12,17H,7H2,1-2H3 |
| InChIKey | BJJFTQYETZVCPI-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 272.30 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2,3-dimethoxy-5,6-dihydrobenzo[b][1]benzoxepin-5-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,3-dimethoxy-5,6-dihydrobenzo[b][1]benzoxepin-5-ol?
The IUPAC name of 2,3-dimethoxy-5,6-dihydrobenzo[b][1]benzoxepin-5-ol (CID 134869505) is 2,3-dimethoxy-5,6-dihydrobenzo[b][1]benzoxepin-5-ol.
What is the SMILES notation for 2,3-dimethoxy-5,6-dihydrobenzo[b][1]benzoxepin-5-ol?
The canonical SMILES for 2,3-dimethoxy-5,6-dihydrobenzo[b][1]benzoxepin-5-ol is COc1cc2c(cc1OC)C(O)Cc1ccccc1O2.
What is the InChIKey of 2,3-dimethoxy-5,6-dihydrobenzo[b][1]benzoxepin-5-ol?
The InChIKey is BJJFTQYETZVCPI-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H16O4/c1-18-15-8-11-12(17)7-10-5-3-4-6-13(10)20-14(11)9-16(15)19-2/h3-6,8-9,12,17H,7H2,1-2H3.
What are the key properties of 2,3-dimethoxy-5,6-dihydrobenzo[b][1]benzoxepin-5-ol?
2,3-dimethoxy-5,6-dihydrobenzo[b][1]benzoxepin-5-ol has a molecular weight of 272.30 g/mol, XLogP of 3.09, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2,3-dimethoxy-5,6-dihydrobenzo[b][1]benzoxepin-5-ol is sourced from PubChem (CID 134869505), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).