C16H16O4 — CID 16679967
2-(2,3-dihydro-1-benzofuran-2-yl)-4,6-dimethoxyphenol (PubChem CID 16679967) has the molecular formula C16H16O4 and a molecular weight of 272.30 g/mol. Its IUPAC name is 2-(2,3-dihydro-1-benzofuran-2-yl)-4,6-dimethoxyphenol.
| Compound Name | 2-(2,3-dihydro-1-benzofuran-2-yl)-4,6-dimethoxyphenol |
|---|---|
| PubChem CID | 16679967 |
| Molecular Formula | C16H16O4 |
| Molecular Weight | 272.30 g/mol |
| Exact Mass | 272.10 |
| IUPAC Name | 2-(2,3-dihydro-1-benzofuran-2-yl)-4,6-dimethoxyphenol |
| SMILES | COc1cc(OC)c(O)c(C2Cc3ccccc3O2)c1 |
| InChI | InChI=1S/C16H16O4/c1-18-11-8-12(16(17)15(9-11)19-2)14-7-10-5-3-4-6-13(10)20-14/h3-6,8-9,14,17H,7H2,1-2H3 |
| InChIKey | DGLCSBIQWVJZDY-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.30 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |