C10H18N2O2 — CID 165355951
hexyl 4,5-dihydro-1H-pyrazole-3-carboxylate (PubChem CID 165355951) has the molecular formula C10H18N2O2 and a molecular weight of 198.27 g/mol. Its IUPAC name is hexyl 4,5-dihydro-1H-pyrazole-3-carboxylate.
| Compound Name | hexyl 4,5-dihydro-1H-pyrazole-3-carboxylate |
|---|---|
| PubChem CID | 165355951 |
| Molecular Formula | C10H18N2O2 |
| Molecular Weight | 198.27 g/mol |
| Exact Mass | 198.14 |
| IUPAC Name | hexyl 4,5-dihydro-1H-pyrazole-3-carboxylate |
| SMILES | CCCCCCOC(=O)C1=NNCC1 |
| InChI | InChI=1S/C10H18N2O2/c1-2-3-4-5-8-14-10(13)9-6-7-11-12-9/h11H,2-8H2,1H3 |
| InChIKey | SJNJEHGFEAPTMZ-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 50.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.27 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|