C14H9N3O2 — CID 165357898
8-nitro-2-phenyl-1,6-naphthyridine (PubChem CID 165357898) has the molecular formula C14H9N3O2 and a molecular weight of 251.25 g/mol. Its IUPAC name is 8-nitro-2-phenyl-1,6-naphthyridine.
| Compound Name | 8-nitro-2-phenyl-1,6-naphthyridine |
|---|---|
| PubChem CID | 165357898 |
| Molecular Formula | C14H9N3O2 |
| Molecular Weight | 251.25 g/mol |
| Exact Mass | 251.07 |
| IUPAC Name | 8-nitro-2-phenyl-1,6-naphthyridine |
| SMILES | O=[N+]([O-])c1cncc2ccc(-c3ccccc3)nc12 |
| InChI | InChI=1S/C14H9N3O2/c18-17(19)13-9-15-8-11-6-7-12(16-14(11)13)10-4-2-1-3-5-10/h1-9H |
| InChIKey | BLFNIUQURIBDNR-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 68.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.25 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|