C15H10NO- — CID 22660489
2-phenylquinolin-8-olate (PubChem CID 22660489) has the molecular formula C15H10NO- and a molecular weight of 220.25 g/mol. Its IUPAC name is 2-phenylquinolin-8-olate.
| Compound Name | 2-phenylquinolin-8-olate |
|---|---|
| PubChem CID | 22660489 |
| Molecular Formula | C15H10NO- |
| Molecular Weight | 220.25 g/mol |
| Exact Mass | 220.08 |
| IUPAC Name | 2-phenylquinolin-8-olate |
| SMILES | [O-]c1cccc2ccc(-c3ccccc3)nc12 |
| InChI | InChI=1S/C15H11NO/c17-14-8-4-7-12-9-10-13(16-15(12)14)11-5-2-1-3-6-11/h1-10,17H/p-1 |
| InChIKey | WOEZGUUDQZLTCQ-UHFFFAOYSA-M |
| XLogP | 2.98 |
| TPSA | 35.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.25 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |