About 2-phenylquinolin-8-amine
2-phenylquinolin-8-amine (PubChem CID 19955861) has the molecular formula C15H12N2
and a molecular weight of 220.28 g/mol. Its IUPAC name is 2-phenylquinolin-8-amine.
Molecular Properties
| Compound Name | 2-phenylquinolin-8-amine |
| PubChem CID | 19955861 |
| Molecular Formula | C15H12N2 |
| Molecular Weight | 220.28 g/mol |
| Exact Mass | 220.10 |
| IUPAC Name | 2-phenylquinolin-8-amine |
| SMILES | Nc1cccc2ccc(-c3ccccc3)nc12 |
| InChI | InChI=1S/C15H12N2/c16-13-8-4-7-12-9-10-14(17-15(12)13)11-5-2-1-3-6-11/h1-10H,16H2 |
| InChIKey | LOXNFXNXRRMUFJ-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 220.28 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 2-phenylquinolin-8-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-phenylquinolin-8-amine?
The IUPAC name of 2-phenylquinolin-8-amine (CID 19955861) is 2-phenylquinolin-8-amine.
What is the SMILES notation for 2-phenylquinolin-8-amine?
The canonical SMILES for 2-phenylquinolin-8-amine is Nc1cccc2ccc(-c3ccccc3)nc12.
What is the InChIKey of 2-phenylquinolin-8-amine?
The InChIKey is LOXNFXNXRRMUFJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H12N2/c16-13-8-4-7-12-9-10-14(17-15(12)13)11-5-2-1-3-6-11/h1-10H,16H2.
What are the key properties of 2-phenylquinolin-8-amine?
2-phenylquinolin-8-amine has a molecular weight of 220.28 g/mol, XLogP of 3.48, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-phenylquinolin-8-amine is sourced from PubChem (CID 19955861), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).