C10H17N2O4PS — CID 165360241
diethoxy-(2-methoxy-6-methylpyrimidin-4-yl)oxy-sulfanylidene-λ5-phosphane (PubChem CID 165360241) has the molecular formula C10H17N2O4PS and a molecular weight of 292.30 g/mol. Its IUPAC name is diethoxy-(2-methoxy-6-methylpyrimidin-4-yl)oxy-sulfanylidene-λ5-phosphane.
| Compound Name | diethoxy-(2-methoxy-6-methylpyrimidin-4-yl)oxy-sulfanylidene-λ5-phosphane |
|---|---|
| PubChem CID | 165360241 |
| Molecular Formula | C10H17N2O4PS |
| Molecular Weight | 292.30 g/mol |
| Exact Mass | 292.06 |
| IUPAC Name | diethoxy-(2-methoxy-6-methylpyrimidin-4-yl)oxy-sulfanylidene-λ5-phosphane |
| SMILES | CCOP(=S)(OCC)Oc1cc(C)nc(OC)n1 |
| InChI | InChI=1S/C10H17N2O4PS/c1-5-14-17(18,15-6-2)16-9-7-8(3)11-10(12-9)13-4/h7H,5-6H2,1-4H3 |
| InChIKey | JPAJTPFDIZFTJN-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 62.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.30 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|