C18H33O10P — CID 165361343
bis(2-butoxyethyl) 2-(2,3,4-trioxobutoxy)ethyl phosphate (PubChem CID 165361343) has the molecular formula C18H33O10P and a molecular weight of 440.43 g/mol. Its IUPAC name is bis(2-butoxyethyl) 2-(2,3,4-trioxobutoxy)ethyl phosphate.
| Compound Name | bis(2-butoxyethyl) 2-(2,3,4-trioxobutoxy)ethyl phosphate |
|---|---|
| PubChem CID | 165361343 |
| Molecular Formula | C18H33O10P |
| Molecular Weight | 440.43 g/mol |
| Exact Mass | 440.18 |
| IUPAC Name | bis(2-butoxyethyl) 2-(2,3,4-trioxobutoxy)ethyl phosphate |
| SMILES | CCCCOCCOP(=O)(OCCOCCCC)OCCOCC(=O)C(=O)C=O |
| InChI | InChI=1S/C18H33O10P/c1-3-5-7-23-9-12-26-29(22,27-13-10-24-8-6-4-2)28-14-11-25-16-18(21)17(20)15-19/h15H,3-14,16H2,1-2H3 |
| InChIKey | IBVXPFDYOBHLFO-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 123.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.43 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|