About 1-butoxypentane-2,3-dione
1-butoxypentane-2,3-dione (PubChem CID 154085717) has the molecular formula C9H16O3
and a molecular weight of 172.22 g/mol. Its IUPAC name is 1-butoxypentane-2,3-dione.
Molecular Properties
| Compound Name | 1-butoxypentane-2,3-dione |
| PubChem CID | 154085717 |
| Molecular Formula | C9H16O3 |
| Molecular Weight | 172.22 g/mol |
| Exact Mass | 172.11 |
| IUPAC Name | 1-butoxypentane-2,3-dione |
| SMILES | CCCCOCC(=O)C(=O)CC |
| InChI | InChI=1S/C9H16O3/c1-3-5-6-12-7-9(11)8(10)4-2/h3-7H2,1-2H3 |
| InChIKey | OCGHKBYCWDBOTQ-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 172.22 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|
Analyze 1-butoxypentane-2,3-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-butoxypentane-2,3-dione?
The IUPAC name of 1-butoxypentane-2,3-dione (CID 154085717) is 1-butoxypentane-2,3-dione.
What is the SMILES notation for 1-butoxypentane-2,3-dione?
The canonical SMILES for 1-butoxypentane-2,3-dione is CCCCOCC(=O)C(=O)CC.
What is the InChIKey of 1-butoxypentane-2,3-dione?
The InChIKey is OCGHKBYCWDBOTQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H16O3/c1-3-5-6-12-7-9(11)8(10)4-2/h3-7H2,1-2H3.
What are the key properties of 1-butoxypentane-2,3-dione?
1-butoxypentane-2,3-dione has a molecular weight of 172.22 g/mol, XLogP of 1.35, 7 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-butoxypentane-2,3-dione is sourced from PubChem (CID 154085717), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).