C17H14F21NO4 — CID 165364959
[1-(dimethylamino)-4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,12,12,13,13,13-henicosafluoro-2-(hydroxymethoxy)tridecan-3-yl] formate (PubChem CID 165364959) has the molecular formula C17H14F21NO4 and a molecular weight of 695.26 g/mol. Its IUPAC name is [1-(dimethylamino)-4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,12,12,13,13,13-henicosafluoro-2-(hydroxymethoxy)tridecan-3-yl] formate.
| Compound Name | [1-(dimethylamino)-4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,12,12,13,13,13-henicosafluoro-2-(hydroxymethoxy)tridecan-3-yl] formate |
|---|---|
| PubChem CID | 165364959 |
| Molecular Formula | C17H14F21NO4 |
| Molecular Weight | 695.26 g/mol |
| Exact Mass | 695.06 |
| IUPAC Name | [1-(dimethylamino)-4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,12,12,13,13,13-henicosafluoro-2-(hydroxymethoxy)tridecan-3-yl] formate |
| SMILES | CN(C)CC(OCO)C(OC=O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C17H14F21NO4/c1-39(2)3-6(42-4-40)7(43-5-41)8(18,19)9(20,21)10(22,23)11(24,25)12(26,27)13(28,29)14(30,31)15(32,33)16(34,35)17(36,37)38/h5-7,40H,3-4H2,1-2H3 |
| InChIKey | UYNHCFKWAFKTCG-UHFFFAOYSA-N |
| XLogP | 5.70 |
| TPSA | 59.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 695.26 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|